![6-bromo-2-iodofuro[3,2-b]pyridine (CAS: 1171920-55-0) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0755021.png "6-bromo-2-iodofuro[3,2-b]pyridine chemical structure")
6-bromo-2-iodofuro[3,2-b]pyridine
Catalog No: FT-0755021
CAS No: 1171920-55-0
- Chemical Name: 6-bromo-2-iodofuro[3,2-b]pyridine
- Molecular Formula: C7H3BrINO
- Molecular Weight: 323.91
- InChI Key: AKTPLXABDGYVAH-UHFFFAOYSA-N
- InChI: InChI=1S/C7H3BrINO/c8-4-1-6-5(10-3-4)2-7(9)11-6/h1-3H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 1171920-55-0 |
|---|---|
| MF: | C7H3BrINO |
| Density: | N/A |
| Flash_Point: | N/A |
| Melting_Point: | N/A |
| Product_Name: | 6-Bromo-2-iodofuro[3,2-b]pyridine |
| Symbol: | GHS07 |
| Bolling_Point: | N/A |
| FW: | 323.91300 |
| Exact_Mass: | 322.84400 |
|---|---|
| MF: | C7H3BrINO |
| LogP: | 3.19490 |
| PSA: | 26.03000 |
| FW: | 323.91300 |
| Symbol: | GHS07 |
|---|---|
| Safety_Statements: | H302-H319 |
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P305 + P351 + P338 |
