![[2-(2H-tetrazol-5-yl)phenyl]boronic acid (CAS: 155884-01-8) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0726257.png "[2-(2H-tetrazol-5-yl)phenyl]boronic acid chemical structure")
[2-(2H-tetrazol-5-yl)phenyl]boronic acid
Catalog No: FT-0726257
CAS No: 155884-01-8
- Chemical Name: [2-(2H-tetrazol-5-yl)phenyl]boronic acid
- Molecular Formula: C7H7BN4O2
- Molecular Weight: 189.97
- InChI Key: GVRXWYFECKHTSJ-UHFFFAOYSA-N
- InChI: InChI=1S/C7H7BN4O2/c13-8(14)6-4-2-1-3-5(6)7-9-11-12-10-7/h1-4,13-14H,(H,9,10,11,12)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 155884-01-8 |
|---|---|
| MF: | C7H7BN4O2 |
| Density: | 1.5±0.1 g/cm3 |
| Flash_Point: | 260.5±32.9 °C |
| Melting_Point: | N/A |
| Product_Name: | [2-(1H-Tetrazol-5-yl)phenyl]boronic acid |
| Symbol: | GHS07 |
| Bolling_Point: | 507.1±60.0 °C at 760 mmHg |
| FW: | 189.967 |
| Bolling_Point: | 507.1±60.0 °C at 760 mmHg |
|---|---|
| Density: | 1.5±0.1 g/cm3 |
| MF: | C7H7BN4O2 |
| LogP: | 1.01 |
| Exact_Mass: | 190.066208 |
| Vapor_Pressure: | 0.0±1.4 mmHg at 25°C |
| Flash_Point: | 260.5±32.9 °C |
| FW: | 189.967 |
| Refractive_Index: | 1.642 |
| PSA: | 94.92000 |
| Symbol: | GHS07 |
|---|---|
| Safety_Statements: | H319 |
| Warning_Statement: | P305 + P351 + P338 |
| Hazard_Codes: | Xi: Irritant; |
| HS_Code: | 2933990090 |
| RIDADR: | NONH for all modes of transport |
![2-[4-[(dimethylamino)methyl]phenyl]acetic acid (CAS: 99985-52-1) - Related Chemical Product](/static/img/prod_pic/FT-0737063.png "2-[4-[(dimethylamino)methyl]phenyl]acetic acid chemical structure")
![2-[2-hydroxyethyl-[(4-nitrophenyl)methyl]amino]ethanol (CAS: 99982-60-2) - Related Chemical Product](/static/img/prod_pic/FT-0749988.png "2-[2-hydroxyethyl-[(4-nitrophenyl)methyl]amino]ethanol chemical structure")
