![6-bromo-7-methyl-1H-imidazo[4,5-b]pyridine (CAS: 91996-63-3) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0717386.png "6-bromo-7-methyl-1H-imidazo[4,5-b]pyridine chemical structure")
6-bromo-7-methyl-1H-imidazo[4,5-b]pyridine
Catalog No: FT-0717386
CAS No: 91996-63-3
- Chemical Name: 6-bromo-7-methyl-1H-imidazo[4,5-b]pyridine
- Molecular Formula: C7H6BrN3
- Molecular Weight: 212.05
- InChI Key: XVEGORLAVIFJMX-UHFFFAOYSA-N
- InChI: InChI=1S/C7H6BrN3/c1-4-5(8)2-9-7-6(4)10-3-11-7/h2-3H,1H3,(H,9,10,11)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 91996-63-3 |
|---|---|
| MF: | C7H6BrN3 |
| Density: | N/A |
| Flash_Point: | N/A |
| Melting_Point: | N/A |
| Product_Name: | 6-bromo-7-methyl-1H-imidazo[4,5-b]pyridine |
| Symbol: | GHS07 |
| Bolling_Point: | N/A |
| FW: | 212.04700 |
| Exact_Mass: | 210.97500 |
|---|---|
| MF: | C7H6BrN3 |
| LogP: | 2.02880 |
| PSA: | 41.57000 |
| FW: | 212.04700 |
| Safety_Statements: | H302-H315-H319-H335 |
|---|---|
| Symbol: | GHS07 |
| Warning_Statement: | P261-P305 + P351 + P338 |
| HS_Code: | 2933990090 |
| RIDADR: | NONH for all modes of transport |
