(2-methoxynaphthalen-1-yl)boronic acid
Catalog No: FT-0713509
CAS No: 104116-17-8
- Chemical Name: (2-methoxynaphthalen-1-yl)boronic acid
- Molecular Formula: C11H11BO3
- Molecular Weight: 202.02
- InChI Key: NHVWTZOWDLOBBS-UHFFFAOYSA-N
- InChI: InChI=1S/C11H11BO3/c1-15-10-7-6-8-4-2-3-5-9(8)11(10)12(13)14/h2-7,13-14H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 104116-17-8 |
|---|---|
| MF: | C11H11BO3 |
| Density: | 1.235g/cm3 |
| Flash_Point: | 210.939°C |
| Melting_Point: | N/A |
| Product_Name: | (2-Methoxy-1-Naphthyl)Boronic Acid |
| Symbol: | GHS07 |
| Bolling_Point: | 425.176°C at 760 mmHg |
| FW: | 202.01400 |
| Density: | 1.235g/cm3 |
|---|---|
| MF: | C11H11BO3 |
| LogP: | 0.52820 |
| Exact_Mass: | 202.08000 |
| Bolling_Point: | 425.176°C at 760 mmHg |
| Flash_Point: | 210.939°C |
| FW: | 202.01400 |
| Refractive_Index: | 1.617 |
| PSA: | 49.69000 |
| Safety_Statements: | H315-H319-H335 |
|---|---|
| Symbol: | GHS07 |
| Warning_Statement: | P261-P305 + P351 + P338 |
| HS_Code: | 2931900090 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)