![[4-[(4-cyanato-3,5-dimethylphenyl)methyl]-2,6-dimethylphenyl] cyanate (CAS: 101657-77-6) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0711569.png "[4-[(4-cyanato-3,5-dimethylphenyl)methyl]-2,6-dimethylphenyl] cyanate chemical structure")
[4-[(4-cyanato-3,5-dimethylphenyl)methyl]-2,6-dimethylphenyl] cyanate
Catalog No: FT-0711569
CAS No: 101657-77-6
- Chemical Name: [4-[(4-cyanato-3,5-dimethylphenyl)methyl]-2,6-dimethylphenyl] cyanate
- Molecular Formula: C19H18N2O2
- Molecular Weight: 306.4
- InChI Key: JNCRKOQSRHDNIO-UHFFFAOYSA-N
- InChI: InChI=1S/C19H18N2O2/c1-12-5-16(6-13(2)18(12)22-10-20)9-17-7-14(3)19(23-11-21)15(4)8-17/h5-8H,9H2,1-4H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | 433ºC |
|---|---|
| CAS: | 101657-77-6 |
| MF: | C19H18N2O2 |
| Density: | 1.14 |
| Melting_Point: | 105ºC |
| Product_Name: | [4-[(4-cyanato-3,5-dimethylphenyl)methyl]-2,6-dimethylphenyl] cyanate |
| Flash_Point: | 162ºC |
| FW: | 306.35800 |
| MF: | C19H18N2O2 |
|---|---|
| Density: | 1.14 |
| Exact_Mass: | 306.13700 |
| Vapor_Pressure: | 1.01E-07mmHg at 25°C |
| Flash_Point: | 162ºC |
| PSA: | 66.04000 |
| LogP: | 4.23076 |
| Melting_Point: | 105ºC |
| Bolling_Point: | 433ºC |
| FW: | 306.35800 |
| Refractive_Index: | 1.569 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| Risk_Statements(EU): | R43 |
| Safety_Statements: | 22-24-37-61 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)