2,6-dichloro-8-methylquinoline-3-carbaldehyde
Catalog No: FT-0707005
CAS No: 938138-94-4
- Chemical Name: 2,6-dichloro-8-methylquinoline-3-carbaldehyde
- Molecular Formula: C11H7Cl2NO
- Molecular Weight: 240.08
- InChI Key: LQGCPWAESLYAKC-UHFFFAOYSA-N
- InChI: InChI=1S/C11H7Cl2NO/c1-6-2-9(12)4-7-3-8(5-15)11(13)14-10(6)7/h2-5H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 938138-94-4 |
|---|---|
| MF: | C11H7Cl2NO |
| Density: | 1.423g/cm3 |
| Flash_Point: | 180.8ºC |
| Melting_Point: | N/A |
| Product_Name: | 2,6-dichloro-8-methylquinoline-3-carbaldehyde |
| Symbol: | GHS07 |
| Bolling_Point: | 375.3ºC at 760 mmHg |
| FW: | 240.08500 |
| Density: | 1.423g/cm3 |
|---|---|
| MF: | C11H7Cl2NO |
| LogP: | 3.66250 |
| Exact_Mass: | 238.99000 |
| Bolling_Point: | 375.3ºC at 760 mmHg |
| Flash_Point: | 180.8ºC |
| FW: | 240.08500 |
| Refractive_Index: | 1.677 |
| PSA: | 29.96000 |
| Symbol: | GHS07 |
|---|---|
| RIDADR: | NONH for all modes of transport |
| Safety_Statements: | H302 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)