methyl 3-(2-methoxyphenyl)propanoate
Catalog No: FT-0702805
CAS No: 55001-09-7
- Chemical Name: methyl 3-(2-methoxyphenyl)propanoate
- Molecular Formula: C11H14O3
- Molecular Weight: 194.23
- InChI Key: BJDNTBIPIZYXPN-UHFFFAOYSA-N
- InChI: InChI=1S/C11H14O3/c1-13-10-6-4-3-5-9(10)7-8-11(12)14-2/h3-6H,7-8H2,1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 55001-09-7 |
|---|---|
| MF: | C11H14O3 |
| Density: | 1.062g/cm3 |
| Flash_Point: | 104.4ºC |
| Melting_Point: | N/A |
| Product_Name: | Methyl 3-(2-methoxyphenyl)propanoate |
| Symbol: | GHS07 |
| Bolling_Point: | 263ºC at 760 mmHg |
| FW: | 194.22700 |
| Density: | 1.062g/cm3 |
|---|---|
| MF: | C11H14O3 |
| LogP: | 1.80080 |
| Exact_Mass: | 194.09400 |
| Bolling_Point: | 263ºC at 760 mmHg |
| Flash_Point: | 104.4ºC |
| FW: | 194.22700 |
| Refractive_Index: | 1.497 |
| PSA: | 35.53000 |
| Safety_Statements: | H319 |
|---|---|
| Symbol: | GHS07 |
| Warning_Statement: | P305 + P351 + P338 |
| HS_Code: | 2918990090 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)