4-(4-methoxyphenyl)butanoyl chloride
Catalog No: FT-0702543
CAS No: 6836-18-6
- Chemical Name: 4-(4-methoxyphenyl)butanoyl chloride
- Molecular Formula: C11H13ClO2
- Molecular Weight: 212.67
- InChI Key: RMNFNJLSEHCPTJ-UHFFFAOYSA-N
- InChI: InChI=1S/C11H13ClO2/c1-14-10-7-5-9(6-8-10)3-2-4-11(12)13/h5-8H,2-4H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | 307.7±25.0 °C at 760 mmHg |
|---|---|
| CAS: | 6836-18-6 |
| MF: | C11H13ClO2 |
| Density: | 1.1±0.1 g/cm3 |
| Melting_Point: | N/A |
| Product_Name: | 4-(4-Methoxyphenyl)butanoyl chloride |
| Flash_Point: | 114.5±23.6 °C |
| FW: | 212.673 |
| Bolling_Point: | 307.7±25.0 °C at 760 mmHg |
|---|---|
| Density: | 1.1±0.1 g/cm3 |
| MF: | C11H13ClO2 |
| LogP: | 3.00 |
| Exact_Mass: | 212.060410 |
| Vapor_Pressure: | 0.0±0.7 mmHg at 25°C |
| Flash_Point: | 114.5±23.6 °C |
| FW: | 212.673 |
| Refractive_Index: | 1.515 |
| PSA: | 26.30000 |
| HS_Code: | 2918990090 |
|---|
Related Products
Benzofuran,polymer with ethenylbenzene and (1-methylethenyl)benzene (9CI)