Methyl 4-methylthiazole-2-carboxylate
Catalog No: FT-0697694
CAS No: 14542-15-5
- Chemical Name: Methyl 4-methylthiazole-2-carboxylate
- Molecular Formula: C6H7NO2S
- Molecular Weight: 157.19
- InChI Key: QYBUZTKTDPPXJR-UHFFFAOYSA-N
- InChI: InChI=1S/C6H7NO2S/c1-4-3-10-5(7-4)6(8)9-2/h3H,1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 157.190 |
| Density: | 1.2±0.1 g/cm3 |
| CAS: | 14542-15-5 |
| Bolling_Point: | 233.9±33.0 °C at 760 mmHg |
| Product_Name: | Methyl 4-methylthiazole-2-carboxylate |
| Melting_Point: | N/A |
| Flash_Point: | 95.3±25.4 °C |
| MF: | C6H7NO2S |
| Density: | 1.2±0.1 g/cm3 |
|---|---|
| LogP: | 1.28 |
| Flash_Point: | 95.3±25.4 °C |
| Refractive_Index: | 1.535 |
| FW: | 157.190 |
| PSA: | 67.43000 |
| MF: | C6H7NO2S |
| Bolling_Point: | 233.9±33.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.1±0.5 mmHg at 25°C |
| Exact_Mass: | 157.019745 |
| RIDADR: | NONH for all modes of transport |
|---|---|
| Warning_Statement: | P305 + P351 + P338 |
| Safety_Statements: | H319 |
| Symbol: | Warning |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)