8-Methoxy-8-oxooctanoic acid
Catalog No: FT-0694807
CAS No: 3946-32-5
- Chemical Name: 8-Methoxy-8-oxooctanoic acid
- Molecular Formula: C9H16O4
- Molecular Weight: 188.22
- InChI Key: KOVPXZDUVJGGFU-UHFFFAOYSA-N
- InChI: InChI=1S/C9H16O4/c1-13-9(12)7-5-3-2-4-6-8(10)11/h2-7H2,1H3,(H,10,11)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 188.22100 |
| Density: | 1.047 |
| CAS: | 3946-32-5 |
| Bolling_Point: | 185-186ºC18 mm Hg(lit.) |
| Product_Name: | Suberic Acid Monomethyl Ester |
| Melting_Point: | 17-19ºC(lit.) |
| Flash_Point: | 113ºC |
| MF: | C9H16O4 |
| Flash_Point: | 113ºC |
|---|---|
| Refractive_Index: | 1.444 |
| FW: | 188.22100 |
| Bolling_Point: | 185-186ºC18 mm Hg(lit.) |
| Density: | 1.047 |
| LogP: | 1.58460 |
| Melting_Point: | 17-19ºC(lit.) |
| PSA: | 63.60000 |
| MF: | C9H16O4 |
| Exact_Mass: | 188.10500 |
| Personal_Protective_Equipment: | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|---|
| Hazard_Codes: | Xi: Irritant; |
| Risk_Statements(EU): | R36/37/38 |
| Safety_Statements: | 26-37/39 |
| Symbol: | Warning |
| Warning_Statement: | P261-P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2918990090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)