2-hydroxyterephthalic acid
Catalog No: FT-0691714
CAS No: 636-94-2
- Chemical Name: 2-hydroxyterephthalic acid
- Molecular Formula: C8H6O5
- Molecular Weight: 182.13
- InChI Key: CDOWNLMZVKJRSC-UHFFFAOYSA-N
- InChI: InChI=1S/C8H6O5/c9-6-3-4(7(10)11)1-2-5(6)8(12)13/h1-3,9H,(H,10,11)(H,12,13)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 636-94-2 |
| Flash_Point: | 232.2±23.8 °C |
| Product_Name: | 2-Hydroxyterephthalic acid |
| Bolling_Point: | 436.9±40.0 °C at 760 mmHg |
| FW: | 182.130 |
| Melting_Point: | 312-317ºC |
| MF: | C8H6O5 |
| Density: | 1.6±0.1 g/cm3 |
| Melting_Point: | 312-317ºC |
|---|---|
| Refractive_Index: | 1.666 |
| Vapor_Pressure: | 0.0±1.1 mmHg at 25°C |
| MF: | C8H6O5 |
| Flash_Point: | 232.2±23.8 °C |
| LogP: | 2.51 |
| FW: | 182.130 |
| Density: | 1.6±0.1 g/cm3 |
| PSA: | 94.83000 |
| Bolling_Point: | 436.9±40.0 °C at 760 mmHg |
| Exact_Mass: | 182.021530 |
| Symbol: | GHS07 |
|---|---|
| HS_Code: | 2918290000 |
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H302-H315-H319-H335 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)