(2-Ethoxy-5-fluorophenyl)boronic acid
Catalog No: FT-0690290
CAS No: 864301-27-9
- Chemical Name: (2-Ethoxy-5-fluorophenyl)boronic acid
- Molecular Formula: C8H10BFO3
- Molecular Weight: 183.97
- InChI Key: LOVFKIWGXGWXLN-UHFFFAOYSA-N
- InChI: InChI=1S/C8H10BFO3/c1-2-13-8-4-3-6(10)5-7(8)9(11)12/h3-5,11-12H,2H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | (2-Ethoxy-5-fluorophenyl)boronic acid |
|---|---|
| Flash_Point: | 162.5±30.7 °C |
| Melting_Point: | 108-113ºC(lit.) |
| FW: | 183.973 |
| Density: | 1.2±0.1 g/cm3 |
| CAS: | 864301-27-9 |
| Bolling_Point: | 345.1±52.0 °C at 760 mmHg |
| MF: | C8H10BFO3 |
| Density: | 1.2±0.1 g/cm3 |
|---|---|
| LogP: | 2.16 |
| Flash_Point: | 162.5±30.7 °C |
| Melting_Point: | 108-113ºC(lit.) |
| FW: | 183.973 |
| PSA: | 49.69000 |
| Exact_Mass: | 184.070709 |
| MF: | C8H10BFO3 |
| Bolling_Point: | 345.1±52.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.8 mmHg at 25°C |
| Refractive_Index: | 1.501 |
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2931900090 |
| WGK_Germany: | 3 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)