![{3-[(1E)-3-Ethoxy-3-oxo-1-propen-1-yl]phenyl}boronic acid (CAS: 913835-51-5) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0688835.png "{3-[(1E)-3-Ethoxy-3-oxo-1-propen-1-yl]phenyl}boronic acid chemical structure")
{3-[(1E)-3-Ethoxy-3-oxo-1-propen-1-yl]phenyl}boronic acid
Catalog No: FT-0688835
CAS No: 913835-51-5
- Chemical Name: {3-[(1E)-3-Ethoxy-3-oxo-1-propen-1-yl]phenyl}boronic acid
- Molecular Formula: C11H13BO4
- Molecular Weight: 220.03
- InChI Key: UIZGQEYEJKAASO-VOTSOKGWSA-N
- InChI: InChI=1S/C11H13BO4/c1-2-16-11(13)7-6-9-4-3-5-10(8-9)12(14)15/h3-8,14-15H,2H2,1H3/b7-6+
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | (E)-(3-(3-Ethoxy-3-oxoprop-1-en-1-yl)phenyl)boronic acid |
|---|---|
| Flash_Point: | 204.4±29.3 °C |
| Melting_Point: | 141-143ºC |
| FW: | 220.029 |
| Density: | 1.2±0.1 g/cm3 |
| CAS: | 913835-51-5 |
| Bolling_Point: | 414.3±47.0 °C at 760 mmHg |
| MF: | C11H13BO4 |
| Density: | 1.2±0.1 g/cm3 |
|---|---|
| LogP: | 2.08 |
| Flash_Point: | 204.4±29.3 °C |
| Melting_Point: | 141-143ºC |
| FW: | 220.029 |
| PSA: | 66.76000 |
| Exact_Mass: | 220.090683 |
| MF: | C11H13BO4 |
| Bolling_Point: | 414.3±47.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±1.0 mmHg at 25°C |
| Refractive_Index: | 1.540 |
| Hazard_Codes: | Xi |
|---|---|
| HS_Code: | 2931900090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)