2-Chloro-N-ethyl-4-pyrimidinamine
Catalog No: FT-0688681
CAS No: 86443-51-8
- Chemical Name: 2-Chloro-N-ethyl-4-pyrimidinamine
- Molecular Formula: C6H8ClN3
- Molecular Weight: 157.60
- InChI Key: CQIZRQZZERNHGF-UHFFFAOYSA-N
- InChI: InChI=1S/C6H8ClN3/c1-2-8-5-3-4-9-6(7)10-5/h3-4H,2H2,1H3,(H,8,9,10)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 157.60100 |
| Density: | 1.273g/cm3 |
| CAS: | 86443-51-8 |
| Bolling_Point: | 322.6ºC at 760 mmHg |
| Product_Name: | 2-chloro-N-ethyl-4-pyrimidinamine |
| Melting_Point: | N/A |
| Flash_Point: | 148.9ºC |
| MF: | C6H8ClN3 |
| Density: | 1.273g/cm3 |
|---|---|
| LogP: | 1.63480 |
| Flash_Point: | 148.9ºC |
| Refractive_Index: | 1.586 |
| FW: | 157.60100 |
| PSA: | 37.81000 |
| MF: | C6H8ClN3 |
| Bolling_Point: | 322.6ºC at 760 mmHg |
| Exact_Mass: | 157.04100 |
| Symbol: | GHS07 |
|---|---|
| Safety_Statements: | H302 |
| HS_Code: | 2933599090 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)