4-Bromo-3-methyl-1,2-oxazol-5-amine
Catalog No: FT-0687656
CAS No: 33084-49-0
- Chemical Name: 4-Bromo-3-methyl-1,2-oxazol-5-amine
- Molecular Formula: C4H5BrN2O
- Molecular Weight: 177.00
- InChI Key: XCYKKCVEVOZFIL-UHFFFAOYSA-N
- InChI: InChI=1S/C4H5BrN2O/c1-2-3(5)4(6)8-7-2/h6H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 176.99900 |
| Density: | 1.767 g/cm3 |
| CAS: | 33084-49-0 |
| Bolling_Point: | 273.538ºC at 760 mmHg |
| Product_Name: | 5-Amino-4-bromo-3-methylisoxazole |
| Melting_Point: | N/A |
| Flash_Point: | 119.232ºC |
| MF: | C4H5BrN2O |
| Density: | 1.767 g/cm3 |
|---|---|
| LogP: | 1.90890 |
| Flash_Point: | 119.232ºC |
| FW: | 176.99900 |
| PSA: | 52.05000 |
| MF: | C4H5BrN2O |
| Bolling_Point: | 273.538ºC at 760 mmHg |
| Exact_Mass: | 175.95900 |
| Warning_Statement: | P261-P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H302-H315-H319-H335 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2934999090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)