![5-Bromo[1,2,4]triazolo[1,5-a]pyridine (CAS: 143329-58-2) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0685487.png "5-Bromo[1,2,4]triazolo[1,5-a]pyridine chemical structure")
5-Bromo[1,2,4]triazolo[1,5-a]pyridine
Catalog No: FT-0685487
CAS No: 143329-58-2
- Chemical Name: 5-Bromo[1,2,4]triazolo[1,5-a]pyridine
- Molecular Formula: C6H4BrN3
- Molecular Weight: 198.02
- InChI Key: FTRKHVUBTUHSQK-UHFFFAOYSA-N
- InChI: InChI=1S/C6H4BrN3/c7-5-2-1-3-6-8-4-9-10(5)6/h1-4H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 198.020 |
| Density: | 1.9±0.1 g/cm3 |
| CAS: | 143329-58-2 |
| Bolling_Point: | N/A |
| Product_Name: | 5-Bromo-[1,2,4]triazolo[1,5-a]pyridine |
| Melting_Point: | N/A |
| Flash_Point: | N/A |
| MF: | C6H4BrN3 |
| Density: | 1.9±0.1 g/cm3 |
|---|---|
| LogP: | 1.45 |
| Refractive_Index: | 1.751 |
| FW: | 198.020 |
| PSA: | 30.19000 |
| MF: | C6H4BrN3 |
| Exact_Mass: | 196.958847 |
| Warning_Statement: | P261-P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H315-H319-H335 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
