![2,4-Dichloro-5H,6H,7H-cyclopenta[d]pyrimidine (CAS: 5466-43-3) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0682903.png "2,4-Dichloro-5H,6H,7H-cyclopenta[d]pyrimidine chemical structure")
2,4-Dichloro-5H,6H,7H-cyclopenta[d]pyrimidine
Catalog No: FT-0682903
CAS No: 5466-43-3
- Chemical Name: 2,4-Dichloro-5H,6H,7H-cyclopenta[d]pyrimidine
- Molecular Formula: C7H6Cl2N2
- Molecular Weight: 189.04
- InChI Key: GDHHAOFBLGZCMI-UHFFFAOYSA-N
- InChI: InChI=1S/C7H6Cl2N2/c8-6-4-2-1-3-5(4)10-7(9)11-6/h1-3H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 189.042 |
| Density: | 1.5±0.1 g/cm3 |
| CAS: | 5466-43-3 |
| Bolling_Point: | 306.7±42.0 °C at 760 mmHg |
| Product_Name: | 2,4-dichloro-6,7-dihydro-5H-cyclopenta[d]pyrimidine |
| Melting_Point: | 70-72ºC |
| Flash_Point: | 168.1±13.5 °C |
| MF: | C7H6Cl2N2 |
| Density: | 1.5±0.1 g/cm3 |
|---|---|
| LogP: | 2.28 |
| Flash_Point: | 168.1±13.5 °C |
| Melting_Point: | 70-72ºC |
| FW: | 189.042 |
| PSA: | 25.78000 |
| Exact_Mass: | 187.990799 |
| MF: | C7H6Cl2N2 |
| Bolling_Point: | 306.7±42.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| Refractive_Index: | 1.605 |
| Warning_Statement: | P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H302-H319 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
Related Products
4-Nitrophenyl 2-Acetamido-6-O-(2-acetamido-2-deoxy-b-D-glucopyranosyl) -3-O-(b-D-galactopyranosyl)-2-deoxy-a-D-galactopyranoside
