3-Methyloxetan-3-amine
Catalog No: FT-0682345
CAS No: 874473-14-0
- Chemical Name: 3-Methyloxetan-3-amine
- Molecular Formula: C4H9NO
- Molecular Weight: 87.12
- InChI Key: NQVWMPOQWBDSAI-UHFFFAOYSA-N
- InChI: InChI=1S/C4H9NO/c1-4(5)2-6-3-4/h2-3,5H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 87.120 |
| Density: | 1.0±0.1 g/cm3 |
| CAS: | 874473-14-0 |
| Bolling_Point: | 101.8±33.0 °C at 760 mmHg |
| Product_Name: | 3-Methyl-3-oxetanamine |
| Melting_Point: | N/A |
| Flash_Point: | 17.4±18.6 °C |
| MF: | C4H9NO |
| Density: | 1.0±0.1 g/cm3 |
|---|---|
| LogP: | -0.74 |
| Flash_Point: | 17.4±18.6 °C |
| Refractive_Index: | 1.449 |
| FW: | 87.120 |
| PSA: | 35.25000 |
| MF: | C4H9NO |
| Bolling_Point: | 101.8±33.0 °C at 760 mmHg |
| Vapor_Pressure: | 34.6±0.2 mmHg at 25°C |
| Exact_Mass: | 87.068413 |
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H302-H315-H318-H335 |
| Symbol: | Danger |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2932999099 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)