![5-Fluoro-1H-pyrrolo[2,3-b]pyridin-2(3H)-one (CAS: 1190314-85-2) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0681949.png "5-Fluoro-1H-pyrrolo[2,3-b]pyridin-2(3H)-one chemical structure")
5-Fluoro-1H-pyrrolo[2,3-b]pyridin-2(3H)-one
Catalog No: FT-0681949
CAS No: 1190314-85-2
- Chemical Name: 5-Fluoro-1H-pyrrolo[2,3-b]pyridin-2(3H)-one
- Molecular Formula: C7H5FN2O
- Molecular Weight: 152.13
- InChI Key: LXKVLRLIJKXICE-UHFFFAOYSA-N
- InChI: InChI=1S/C7H5FN2O/c8-5-1-4-2-6(11)10-7(4)9-3-5/h1,3H,2H2,(H,9,10,11)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 5-Fluoro-1H-pyrrolo[2,3-b]pyridin-2(3H)-one |
|---|---|
| Flash_Point: | 155.7±27.9 °C |
| Melting_Point: | N/A |
| FW: | 152.126 |
| Density: | 1.4±0.1 g/cm3 |
| CAS: | 1190314-85-2 |
| Bolling_Point: | 333.8±42.0 °C at 760 mmHg |
| MF: | C7H5FN2O |
| Density: | 1.4±0.1 g/cm3 |
|---|---|
| LogP: | 0.90 |
| Flash_Point: | 155.7±27.9 °C |
| Refractive_Index: | 1.566 |
| FW: | 152.126 |
| PSA: | 41.99000 |
| MF: | C7H5FN2O |
| Bolling_Point: | 333.8±42.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.7 mmHg at 25°C |
| Exact_Mass: | 152.038589 |
| RIDADR: | NONH for all modes of transport |
|---|
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-