![4-Chloro-5-fluoro-1H-pyrrolo[2,3-b]pyridine (CAS: 882033-66-1) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0681945.png "4-Chloro-5-fluoro-1H-pyrrolo[2,3-b]pyridine chemical structure")
4-Chloro-5-fluoro-1H-pyrrolo[2,3-b]pyridine
Catalog No: FT-0681945
CAS No: 882033-66-1
- Chemical Name: 4-Chloro-5-fluoro-1H-pyrrolo[2,3-b]pyridine
- Molecular Formula: C7H4ClFN2
- Molecular Weight: 170.57
- InChI Key: YXRHIFORQJRTTA-UHFFFAOYSA-N
- InChI: InChI=1S/C7H4ClFN2/c8-6-4-1-2-10-7(4)11-3-5(6)9/h1-3H,(H,10,11)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 170.572 |
| Density: | 1.5±0.1 g/cm3 |
| CAS: | 882033-66-1 |
| Bolling_Point: | 297.4±35.0 °C at 760 mmHg |
| Product_Name: | 4-chloro-5-fluoro-1H-pyrrolo[2,3-b]pyridine |
| Melting_Point: | N/A |
| Flash_Point: | 133.7±25.9 °C |
| MF: | C7H4ClFN2 |
| Density: | 1.5±0.1 g/cm3 |
|---|---|
| LogP: | 3.01 |
| Flash_Point: | 133.7±25.9 °C |
| Refractive_Index: | 1.669 |
| FW: | 170.572 |
| PSA: | 28.68000 |
| MF: | C7H4ClFN2 |
| Bolling_Point: | 297.4±35.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| Exact_Mass: | 170.004700 |
| Symbol: | GHS07 |
|---|---|
| Safety_Statements: | H302 |
| HS_Code: | 2933990090 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-