![3,4-Dihydro-2H-pyrano[3,2-b]pyridine (CAS: 70381-92-9) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0681654.webp "3,4-Dihydro-2H-pyrano[3,2-b]pyridine chemical structure")
3,4-Dihydro-2H-pyrano[3,2-b]pyridine
Catalog No: FT-0681654
CAS No: 70381-92-9
- Chemical Name: 3,4-Dihydro-2H-pyrano[3,2-b]pyridine
- Molecular Formula: C8H9NO
- Molecular Weight: 135.16 g/mol
- InChI Key: XNARZJQXBMWIQU-UHFFFAOYSA-N
- InChI: InChI=1S/C8H9NO/c1-4-8-7(9-5-1)3-2-6-10-8/h1,4-5H,2-3,6H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 135.16300 |
| Density: | 1.121 g/cm3 |
| CAS: | 70381-92-9 |
| Bolling_Point: | 227.407ºC at 760 mmHg |
| Product_Name: | 3,4-Dihydro-2H-pyrano[3,2-b]pyridine |
| Melting_Point: | N/A |
| Flash_Point: | 82.684ºC |
| MF: | C8H9NO |
| Density: | 1.121 g/cm3 |
|---|---|
| LogP: | 1.40660 |
| Flash_Point: | 82.684ºC |
| FW: | 135.16300 |
| PSA: | 22.12000 |
| MF: | C8H9NO |
| Bolling_Point: | 227.407ºC at 760 mmHg |
| Exact_Mass: | 135.06800 |
| Warning_Statement: | P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H302-H319 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2934999090 |
