4-(3-Pyridinyl)benzaldehyde
Catalog No: FT-0681604
CAS No: 127406-55-7
- Chemical Name: 4-(3-Pyridinyl)benzaldehyde
- Molecular Formula: C12H9NO
- Molecular Weight: 183.21
- InChI Key: NXZUVHZZIZHEOP-UHFFFAOYSA-N
- InChI: InChI=1S/C12H9NO/c14-9-10-3-5-11(6-4-10)12-2-1-7-13-8-12/h1-9H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 127406-55-7 |
| Flash_Point: | 173.7±30.6 °C |
| Product_Name: | 4-Pyridin-3-yl-benzaldehyde |
| Bolling_Point: | 350.5±25.0 °C at 760 mmHg |
| FW: | 183.206 |
| Melting_Point: | 54-55ºC |
| MF: | C12H9NO |
| Density: | 1.1±0.1 g/cm3 |
| Refractive_Index: | 1.615 |
|---|---|
| Vapor_Pressure: | 0.0±0.8 mmHg at 25°C |
| Flash_Point: | 173.7±30.6 °C |
| LogP: | 1.97 |
| Bolling_Point: | 350.5±25.0 °C at 760 mmHg |
| FW: | 183.206 |
| PSA: | 29.96000 |
| Melting_Point: | 54-55ºC |
| MF: | C12H9NO |
| Exact_Mass: | 183.068420 |
| Density: | 1.1±0.1 g/cm3 |
| Symbol: | GHS07 |
|---|---|
| Risk_Statements(EU): | R22;R36/37/38 |
| HS_Code: | 2933399090 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xn:Harmful; |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H315-H319-H335 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)