2-Amino-1-morpholino-1-ethanone hydrochloride
Catalog No: FT-0680619
CAS No: 24152-96-3
- Chemical Name: 2-Amino-1-morpholino-1-ethanone hydrochloride
- Molecular Formula: C6H13ClN2O2
- Molecular Weight: 180.63
- InChI Key: XNMVLMPXYUXCBV-UHFFFAOYSA-N
- InChI: InChI=1S/C6H12N2O2.ClH/c7-5-6(9)8-1-3-10-4-2-8;/h1-5,7H2;1H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 180.633 |
| Density: | N/A |
| CAS: | 24152-96-3 |
| Bolling_Point: | 332.6ºC at 760 mmHg |
| Product_Name: | 2-Amino-1-morpholino-1-ethanone hydrochloride |
| Melting_Point: | 245-246ºC |
| Flash_Point: | 155ºC |
| MF: | C6H13ClN2O2 |
| LogP: | 0.24410 |
|---|---|
| Flash_Point: | 155ºC |
| Melting_Point: | 245-246ºC |
| FW: | 180.633 |
| PSA: | 55.56000 |
| MF: | C6H13ClN2O2 |
| Bolling_Point: | 332.6ºC at 760 mmHg |
| Vapor_Pressure: | 0.000104mmHg at 25°C |
| Exact_Mass: | 180.066559 |
| Hazard_Codes: | Xi |
|---|---|
| Warning_Statement: | P305 + P351 + P338 |
| Safety_Statements: | H319 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2934999090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)