Ethyl 4-methyl-2-(2-thienyl)-1,3-thiazole-5-carboxylate
Catalog No: FT-0680278
CAS No: 56421-62-6
- Chemical Name: Ethyl 4-methyl-2-(2-thienyl)-1,3-thiazole-5-carboxylate
- Molecular Formula: C11H11NO2S2
- Molecular Weight: 253.3
- InChI Key: NRTAQEAHFFIBFX-UHFFFAOYSA-N
- InChI: InChI=1S/C11H11NO2S2/c1-3-14-11(13)9-7(2)12-10(16-9)8-5-4-6-15-8/h4-6H,3H2,1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS05 |
|---|---|
| CAS: | 56421-62-6 |
| Flash_Point: | 184.1±30.1 °C |
| Product_Name: | ethyl 4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carboxylate |
| Bolling_Point: | 380.9±50.0 °C at 760 mmHg |
| FW: | 253.340 |
| Melting_Point: | 66-68ºC |
| MF: | C11H11NO2S2 |
| Density: | 1.3±0.1 g/cm3 |
| Melting_Point: | 66-68ºC |
|---|---|
| Refractive_Index: | 1.593 |
| Vapor_Pressure: | 0.0±0.9 mmHg at 25°C |
| MF: | C11H11NO2S2 |
| Flash_Point: | 184.1±30.1 °C |
| LogP: | 3.81 |
| FW: | 253.340 |
| Density: | 1.3±0.1 g/cm3 |
| PSA: | 95.67000 |
| Bolling_Point: | 380.9±50.0 °C at 760 mmHg |
| Exact_Mass: | 253.023117 |
| Symbol: | GHS05 |
|---|---|
| HS_Code: | 2934999090 |
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P280-P305 + P351 + P338 |
| Safety_Statements: | H318 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)