1-(3-Chlorophenyl)-5-oxopyrrolidine-3-carboxylic acid
Catalog No: FT-0679643
CAS No: 92847-41-1
- Chemical Name: 1-(3-Chlorophenyl)-5-oxopyrrolidine-3-carboxylic acid
- Molecular Formula: C11H10ClNO3
- Molecular Weight: 239.65 g/mol
- InChI Key: PBIAEAYJEYOSMG-UHFFFAOYSA-N
- InChI: InChI=1S/C11H10ClNO3/c12-8-2-1-3-9(5-8)13-6-7(11(15)16)4-10(13)14/h1-3,5,7H,4,6H2,(H,15,16)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 1-(3-Chlorophenyl)-5-oxopyrrolidine-3-carboxylic acid |
|---|---|
| Flash_Point: | 281ºC |
| Melting_Point: | N/A |
| FW: | 239.65500 |
| Density: | 1.455g/cm3 |
| CAS: | 92847-41-1 |
| Bolling_Point: | 540.9ºC at 760 mmHg |
| MF: | C11H10ClNO3 |
| Density: | 1.455g/cm3 |
|---|---|
| LogP: | 1.84250 |
| Flash_Point: | 281ºC |
| Refractive_Index: | 1.616 |
| FW: | 239.65500 |
| PSA: | 57.61000 |
| MF: | C11H10ClNO3 |
| Bolling_Point: | 540.9ºC at 760 mmHg |
| Exact_Mass: | 239.03500 |
| HS_Code: | 2933790090 |
|---|
Related Products
Ramelteon Metabolite M-II (mixture of R and S at the hydroxy position)