![7-Methoxy-4,5-dihydronaphtho[1,2-b]thiophene-2-carboxylic acid (CAS: 78554-65-1) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0679251.png "7-Methoxy-4,5-dihydronaphtho[1,2-b]thiophene-2-carboxylic acid chemical structure")
7-Methoxy-4,5-dihydronaphtho[1,2-b]thiophene-2-carboxylic acid
Catalog No: FT-0679251
CAS No: 78554-65-1
- Chemical Name: 7-Methoxy-4,5-dihydronaphtho[1,2-b]thiophene-2-carboxylic acid
- Molecular Formula: C14H12O3S
- Molecular Weight: 260.31
- InChI Key: QMMBYYCLUIZAIF-UHFFFAOYSA-N
- InChI: InChI=1S/C14H12O3S/c1-17-10-4-5-11-8(6-10)2-3-9-7-12(14(15)16)18-13(9)11/h4-7H,2-3H2,1H3,(H,15,16)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | N/A |
|---|---|
| CAS: | 78554-65-1 |
| MF: | C14H12O3S |
| Flash_Point: | 249.4ºC |
| Product_Name: | 7-methoxy-4,5-dihydrobenzo[g][1]benzothiole-2-carboxylic acid |
| Density: | 1.355g/cm3 |
| FW: | 260.30800 |
| Bolling_Point: | 488.8ºC at 760 mmHg |
| Refractive_Index: | 1.653 |
|---|---|
| MF: | C14H12O3S |
| Flash_Point: | 249.4ºC |
| LogP: | 3.22050 |
| FW: | 260.30800 |
| Density: | 1.355g/cm3 |
| PSA: | 74.77000 |
| Bolling_Point: | 488.8ºC at 760 mmHg |
| Exact_Mass: | 260.05100 |
| HS_Code: | 2934999090 |
|---|
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)