![3-Iodo-5-methyl-1H-pyrrolo[2,3-b]pyridine (CAS: 1138443-83-0) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0678834.png "3-Iodo-5-methyl-1H-pyrrolo[2,3-b]pyridine chemical structure")
3-Iodo-5-methyl-1H-pyrrolo[2,3-b]pyridine
Catalog No: FT-0678834
CAS No: 1138443-83-0
- Chemical Name: 3-Iodo-5-methyl-1H-pyrrolo[2,3-b]pyridine
- Molecular Formula: C8H7IN2
- Molecular Weight: 258.06
- InChI Key: SUTAZURMHGAKLC-UHFFFAOYSA-N
- InChI: InChI=1S/C8H7IN2/c1-5-2-6-7(9)4-11-8(6)10-3-5/h2-4H,1H3,(H,10,11)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 258.059 |
| Density: | 1.9±0.1 g/cm3 |
| CAS: | 1138443-83-0 |
| Bolling_Point: | 369.9±37.0 °C at 760 mmHg |
| Product_Name: | 3-Iodo-5-methyl-7-azaindole |
| Melting_Point: | N/A |
| Flash_Point: | 177.5±26.5 °C |
| MF: | C8H7IN2 |
| Density: | 1.9±0.1 g/cm3 |
|---|---|
| LogP: | 3.28 |
| Flash_Point: | 177.5±26.5 °C |
| Refractive_Index: | 1.750 |
| FW: | 258.059 |
| PSA: | 28.68000 |
| MF: | C8H7IN2 |
| Bolling_Point: | 369.9±37.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.8 mmHg at 25°C |
| Exact_Mass: | 257.965393 |
| RIDADR: | NONH for all modes of transport |
|---|---|
| Warning_Statement: | P301 + P312 + P330-P305 + P351 + P338 |
| Safety_Statements: | H302-H315-H319-H335 |
| Symbol: | Warning |
