1-Amino-4-oxocyclohexanecarboxylic acid ethyleneketal
Catalog No: FT-0678224
CAS No: 54621-18-0
- Chemical Name: 1-Amino-4-oxocyclohexanecarboxylic acid ethyleneketal
- Molecular Formula: C9H15NO4
- Molecular Weight: 201.22
- InChI Key: HIIFALCQUKTUHB-UHFFFAOYSA-N
- InChI: InChI=1S/C9H15NO4/c10-8(7(11)12)1-3-9(4-2-8)13-5-6-14-9/h1-6,10H2,(H,11,12)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 201.220 |
| Density: | 1.3±0.1 g/cm3 |
| CAS: | 54621-18-0 |
| Bolling_Point: | 372.1±42.0 °C at 760 mmHg |
| Product_Name: | 1-amino-4-oxocyclohexanecarboxylic acid ethylene ketal |
| Melting_Point: | 301-304ºC |
| Flash_Point: | 178.8±27.9 °C |
| MF: | C9H15NO4 |
| Density: | 1.3±0.1 g/cm3 |
|---|---|
| LogP: | -0.17 |
| Flash_Point: | 178.8±27.9 °C |
| Melting_Point: | 301-304ºC |
| FW: | 201.220 |
| PSA: | 81.78000 |
| Exact_Mass: | 201.100113 |
| MF: | C9H15NO4 |
| Bolling_Point: | 372.1±42.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±1.8 mmHg at 25°C |
| Refractive_Index: | 1.550 |
| Hazard_Codes: | Xi |
|---|---|
| Warning_Statement: | P280-P305 + P351 + P338 |
| Safety_Statements: | S24/25 |
| Symbol: | Danger |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2932999099 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)