3-Iodo-5-methoxy-pyridine
Catalog No: FT-0678195
CAS No: 873302-36-4
- Chemical Name: 3-Iodo-5-methoxy-pyridine
- Molecular Formula: C6H6INO
- Molecular Weight: 235.02
- InChI Key: UJKNMHKWMSUTME-UHFFFAOYSA-N
- InChI: InChI=1S/C6H6INO/c1-9-6-2-5(7)3-8-4-6/h2-4H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 235.022 |
| Density: | 1.8±0.1 g/cm3 |
| CAS: | 873302-36-4 |
| Bolling_Point: | 274.0±20.0 °C at 760 mmHg |
| Product_Name: | 3-Iodo-5-methoxypyridine |
| Melting_Point: | 53-54ºC |
| Flash_Point: | 119.5±21.8 °C |
| MF: | C6H6INO |
| Density: | 1.8±0.1 g/cm3 |
|---|---|
| LogP: | 1.93 |
| Flash_Point: | 119.5±21.8 °C |
| Melting_Point: | 53-54ºC |
| FW: | 235.022 |
| PSA: | 22.12000 |
| Exact_Mass: | 234.949402 |
| MF: | C6H6INO |
| Bolling_Point: | 274.0±20.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.5 mmHg at 25°C |
| Refractive_Index: | 1.598 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| Safety_Statements: | H302 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933399090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)