4-(2-Oxo-pyrrolidin-1-yl)-butyric acid
Catalog No: FT-0677236
CAS No: 6739-80-6
- Chemical Name: 4-(2-Oxo-pyrrolidin-1-yl)-butyric acid
- Molecular Formula: C8H13NO3
- Molecular Weight: 171.19
- InChI Key: WRDMYTORSDPYMO-UHFFFAOYSA-N
- InChI: InChI=1S/C8H13NO3/c10-7-3-1-5-9(7)6-2-4-8(11)12/h1-6H2,(H,11,12)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 171.19400 |
| Density: | 1.209g/cm3 |
| CAS: | 6739-80-6 |
| Bolling_Point: | 402.6ºC at 760 mmHg |
| Product_Name: | 4-(2-oxopyrrolidin-1-yl)butanoic acid |
| Melting_Point: | N/A |
| Flash_Point: | 197.3ºC |
| MF: | C8H13NO3 |
| Density: | 1.209g/cm3 |
|---|---|
| LogP: | 0.41150 |
| Flash_Point: | 197.3ºC |
| Refractive_Index: | 1.509 |
| FW: | 171.19400 |
| PSA: | 57.61000 |
| MF: | C8H13NO3 |
| Bolling_Point: | 402.6ºC at 760 mmHg |
| Exact_Mass: | 171.09000 |
| Hazard_Codes: | Xi |
|---|---|
| Warning_Statement: | P305 + P351 + P338 |
| Safety_Statements: | H319 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933790090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)