o-Nitrophenyl Benzyl Ether
Catalog No: FT-0672848
CAS No: 4560-41-2
- Chemical Name: o-Nitrophenyl Benzyl Ether
- Molecular Formula: C13H11NO3
- Molecular Weight: 229.23
- InChI Key: ZYWSXGRMDPBISP-UHFFFAOYSA-N
- InChI: InChI=1S/C13H11NO3/c15-14(16)12-8-4-5-9-13(12)17-10-11-6-2-1-3-7-11/h1-9H,10H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 1-Benzyloxy-2-nitro-benzene |
|---|---|
| Flash_Point: | 170.6ºC |
| Melting_Point: | N/A |
| FW: | 229.23100 |
| Density: | 1.225 g/mL at 20ºC(lit.) |
| CAS: | 4560-41-2 |
| Bolling_Point: | 377.8ºC at 760 mmHg |
| MF: | C13H11NO3 |
| Density: | 1.225 g/mL at 20ºC(lit.) |
|---|---|
| LogP: | 3.69700 |
| Flash_Point: | 170.6ºC |
| Refractive_Index: | n20/D 1.598 |
| FW: | 229.23100 |
| PSA: | 55.05000 |
| MF: | C13H11NO3 |
| Bolling_Point: | 377.8ºC at 760 mmHg |
| Exact_Mass: | 229.07400 |
| Hazard_Codes: | Xi |
|---|---|
| HS_Code: | 2909309090 |
| Safety_Statements: | 23-24/25 |
Related Products
Ramelteon Metabolite M-II (mixture of R and S at the hydroxy position)
