2'-C-Methyl Cytidine
Catalog No: FT-0671639
CAS No: 20724-73-6
- Chemical Name: 2'-C-Methyl Cytidine
- Molecular Formula: C10H15N3O5
- Molecular Weight: 257.24
- InChI Key: PPUDLEUZKVJXSZ-VPCXQMTMSA-N
- InChI: InChI=1S/C10H15N3O5/c1-10(17)7(15)5(4-14)18-8(10)13-3-2-6(11)12-9(13)16/h2-3,5,7-8,14-15,17H,4H2,1H3,(H2,11,12,16)/t5-,7-,8-,10-/m1/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 257.243 |
| Density: | 1.7±0.1 g/cm3 |
| CAS: | 20724-73-6 |
| Bolling_Point: | 523.9±60.0 °C at 760 mmHg |
| Product_Name: | 2'-C-Methylcytidine |
| Melting_Point: | 243-245ºC |
| Flash_Point: | 270.7±32.9 °C |
| MF: | C10H15N3O5 |
| LogP: | -0.80 |
|---|---|
| Flash_Point: | 270.7±32.9 °C |
| Refractive_Index: | 1.700 |
| FW: | 257.243 |
| Bolling_Point: | 523.9±60.0 °C at 760 mmHg |
| Density: | 1.7±0.1 g/cm3 |
| Melting_Point: | 243-245ºC |
| PSA: | 130.83000 |
| Exact_Mass: | 257.101166 |
| Vapor_Pressure: | 0.0±3.1 mmHg at 25°C |
| MF: | C10H15N3O5 |
| Warning_Statement: | P261-P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H315-H319-H335 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2934999090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)