4'-Hydroxy Diclofenac
Catalog No: FT-0669355
CAS No: 64118-84-9
- Chemical Name: 4'-Hydroxy Diclofenac
- Molecular Formula: C14H11Cl2NO3
- Molecular Weight: 312.1
- InChI Key: KGVXVPRLBMWZLG-UHFFFAOYSA-N
- InChI: InChI=1S/C14H11Cl2NO3/c15-10-6-9(18)7-11(16)14(10)17-12-4-2-1-3-8(12)5-13(19)20/h1-4,6-7,17-18H,5H2,(H,19,20)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 312.148 |
| Density: | 1.5±0.1 g/cm3 |
| CAS: | 64118-84-9 |
| Bolling_Point: | 432.7±45.0 °C at 760 mmHg |
| Product_Name: | 4'-hydroxydiclofenac |
| Melting_Point: | 178-185ºC dec. |
| Flash_Point: | 215.5±28.7 °C |
| MF: | C14H11Cl2NO3 |
| LogP: | 4.56 |
|---|---|
| Flash_Point: | 215.5±28.7 °C |
| Refractive_Index: | 1.690 |
| FW: | 312.148 |
| Bolling_Point: | 432.7±45.0 °C at 760 mmHg |
| Density: | 1.5±0.1 g/cm3 |
| Melting_Point: | 178-185ºC dec. |
| PSA: | 69.56000 |
| Exact_Mass: | 311.011597 |
| Vapor_Pressure: | 0.0±1.1 mmHg at 25°C |
| MF: | C14H11Cl2NO3 |
| Personal_Protective_Equipment: | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
|---|---|
| RTECS: | AG6542800 |
| Risk_Statements(EU): | R25;R37/38;R41;R50/53 |
| Safety_Statements: | S26-S39-S45-S60-S61 |
| Symbol: | Danger |
| Warning_Statement: | P210-P261-P302 + P352 + P312-P304 + P340 + P312-P337 + P313-P403 + P235 |
| RIDADR: | UN 2811 |
| Hazard_Codes: | T: Toxic;N: Dangerous for the environment; |
| HS_Code: | 2922509090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)