17a-Dihydro Equilin
Catalog No: FT-0667038
CAS No: 651-55-8
- Chemical Name: 17a-Dihydro Equilin
- Molecular Formula: C18H22O2
- Molecular Weight: 270.4
- InChI Key: NLLMJANWPUQQTA-SPUZQDLCSA-N
- InChI: InChI=1S/C18H22O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3-5,10,14,16-17,19-20H,2,6-9H2,1H3/t14-,16+,17-,18+/m1/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 651-55-8 |
| Flash_Point: | 217.155ºC |
| Product_Name: | 17α-Dihydroequilin |
| Bolling_Point: | 457.798ºC at 760 mmHg |
| FW: | 270.36600 |
| Melting_Point: | N/A |
| MF: | C18H22O2 |
| Density: | 1.23g/cm3 |
| Refractive_Index: | 1.637 |
|---|---|
| MF: | C18H22O2 |
| Flash_Point: | 217.155ºC |
| LogP: | 3.52930 |
| FW: | 270.36600 |
| Density: | 1.23g/cm3 |
| PSA: | 40.46000 |
| Bolling_Point: | 457.798ºC at 760 mmHg |
| Exact_Mass: | 270.16200 |
| Symbol: | GHS07 |
|---|---|
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P305 + P351 + P338 |
| Safety_Statements: | H315-H319 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)