![5,10-Dihydro-2-methyl-4H-thieno[2,3-b][1,5]benzodiazepin-4-one(Olanzapine Impurity) (CAS: 221176-49-4) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0666988.png "5,10-Dihydro-2-methyl-4H-thieno[2,3-b][1,5]benzodiazepin-4-one(Olanzapine Impurity) chemical structure")
5,10-Dihydro-2-methyl-4H-thieno[2,3-b][1,5]benzodiazepin-4-one(Olanzapine Impurity)
Catalog No: FT-0666988
CAS No: 221176-49-4
- Chemical Name: 5,10-Dihydro-2-methyl-4H-thieno[2,3-b][1,5]benzodiazepin-4-one(Olanzapine Impurity)
- Molecular Formula: C12H10N2OS
- Molecular Weight: 230.29
- InChI Key: LVTDAJJOMLNXFS-UHFFFAOYSA-N
- InChI: InChI=1S/C12H10N2OS/c1-7-6-8-11(15)13-9-4-2-3-5-10(9)14-12(8)16-7/h2-6,14H,1H3,(H,13,15)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 230.28600 |
| Density: | 1.292g/cm3 |
| CAS: | 221176-49-4 |
| Bolling_Point: | 341.1ºC at 760 mmHg |
| Product_Name: | 2-methyl-5,10-dihydrothieno[3,2-c][1,5]benzodiazepin-4-one |
| Melting_Point: | 235-237ºC |
| Flash_Point: | 160.1ºC |
| MF: | C12H10N2OS |
| Density: | 1.292g/cm3 |
|---|---|
| LogP: | 2.94150 |
| Flash_Point: | 160.1ºC |
| Melting_Point: | 235-237ºC |
| FW: | 230.28600 |
| PSA: | 76.89000 |
| Exact_Mass: | 230.05100 |
| MF: | C12H10N2OS |
| Bolling_Point: | 341.1ºC at 760 mmHg |
| Vapor_Pressure: | 8.24E-05mmHg at 25°C |
| Refractive_Index: | 1.635 |
| RIDADR: | NONH for all modes of transport |
|---|---|
| Warning_Statement: | P261 |
| Safety_Statements: | H335 |
| Symbol: | Warning |
![2-[4-[(dimethylamino)methyl]phenyl]acetic acid (CAS: 99985-52-1) - Related Chemical Product](/static/img/prod_pic/FT-0737063.png "2-[4-[(dimethylamino)methyl]phenyl]acetic acid chemical structure")
![2-[2-hydroxyethyl-[(4-nitrophenyl)methyl]amino]ethanol (CAS: 99982-60-2) - Related Chemical Product](/static/img/prod_pic/FT-0749988.png "2-[2-hydroxyethyl-[(4-nitrophenyl)methyl]amino]ethanol chemical structure")
