1-Chlorobenzotriazole
Catalog No: FT-0664555
CAS No: 21050-95-3
- Chemical Name: 1-Chlorobenzotriazole
- Molecular Formula: C6H4ClN3
- Molecular Weight: 153.57
- InChI Key: INOGLHRUEYDAHX-UHFFFAOYSA-N
- InChI: InChI=1S/C6H4ClN3/c7-10-6-4-2-1-3-5(6)8-9-10/h1-4H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 21050-95-3 |
| Flash_Point: | 124.3ºC |
| Product_Name: | 1-chlorobenzotriazole |
| Bolling_Point: | 282ºC at 760mmHg |
| FW: | 153.56900 |
| Melting_Point: | N/A |
| MF: | C6H4ClN3 |
| Density: | 1.51g/cm3 |
| Refractive_Index: | 1.712 |
|---|---|
| Vapor_Pressure: | 0.00345mmHg at 25°C |
| MF: | C6H4ClN3 |
| Flash_Point: | 124.3ºC |
| LogP: | 1.43320 |
| FW: | 153.56900 |
| Density: | 1.51g/cm3 |
| PSA: | 30.71000 |
| Bolling_Point: | 282ºC at 760mmHg |
| Exact_Mass: | 153.00900 |
| Symbol: | GHS07 |
|---|---|
| HS_Code: | 2933990090 |
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H302-H315-H319-H335 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)