1,3-Bis(4-nitrophenyl)urea-d8
Catalog No: FT-0663356
CAS No: 1156508-87-0
- Chemical Name: 1,3-Bis(4-nitrophenyl)urea-d8
- Molecular Formula: C13H10N4O5
- Molecular Weight: 310.29
- InChI Key: JEZZOKXIXNSKQD-PGRXLJNUSA-N
- InChI: InChI=1S/C13H10N4O5/c18-13(14-9-1-5-11(6-2-9)16(19)20)15-10-3-7-12(8-4-10)17(21)22/h1-8H,(H2,14,15,18)/i1D,2D,3D,4D,5D,6D,7D,8D
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 310.292 |
| Density: | 1.6±0.1 g/cm3 |
| CAS: | 1156508-87-0 |
| Bolling_Point: | 414.8±30.0 °C at 760 mmHg |
| Product_Name: | 1,3-Bis[4-nitro(2H4)phenyl]urea |
| Melting_Point: | >300°C |
| Flash_Point: | 204.7±24.6 °C |
| MF: | C13H2D8N4O5 |
| LogP: | 3.78 |
|---|---|
| Flash_Point: | 204.7±24.6 °C |
| Refractive_Index: | 1.741 |
| FW: | 310.292 |
| Bolling_Point: | 414.8±30.0 °C at 760 mmHg |
| Density: | 1.6±0.1 g/cm3 |
| Melting_Point: | >300°C |
| PSA: | 132.77000 |
| Exact_Mass: | 310.115326 |
| Vapor_Pressure: | 0.0±1.0 mmHg at 25°C |
| MF: | C13H2D8N4O5 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Hazard_Codes: | Xi |
| Risk_Statements(EU): | 36/37/38 |
| Safety_Statements: | 26 |
| Symbol: | Danger |
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)