N-Acetyl-S-(3,4-dihydroxybutyl)-L-cysteine (Mixture of Diastereomers)
Catalog No: FT-0661218
CAS No: 144889-50-9
- Chemical Name: N-Acetyl-S-(3,4-dihydroxybutyl)-L-cysteine (Mixture of Diastereomers)
- Molecular Formula: C9H17NO5S
- Molecular Weight: 251.3
- InChI Key: VGJNEDFZFZCLSX-MQWKRIRWSA-N
- InChI: InChI=1S/C9H17NO5S/c1-6(12)10-8(9(14)15)5-16-3-2-7(13)4-11/h7-8,11,13H,2-5H2,1H3,(H,10,12)(H,14,15)/t7?,8-/m0/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | N-Acetyl-S-(3,4-dihydroxybutyl)-L-cysteine |
|---|---|
| Flash_Point: | 300.438ºC |
| Melting_Point: | N/A |
| FW: | 251.30000 |
| Density: | 1.341g/cm3 |
| CAS: | 144889-50-9 |
| Bolling_Point: | 573.162ºC at 760 mmHg |
| MF: | C9H17NO5S |
| Density: | 1.341g/cm3 |
|---|---|
| Flash_Point: | 300.438ºC |
| Refractive_Index: | 1.552 |
| FW: | 251.30000 |
| PSA: | 132.16000 |
| MF: | C9H17NO5S |
| Bolling_Point: | 573.162ºC at 760 mmHg |
| Vapor_Pressure: | 0mmHg at 25°C |
| Exact_Mass: | 251.08300 |