trans-2-Aminocyclo hexanol hydrochloride
Catalog No: FT-0660301
CAS No: 13374-30-6
- Chemical Name: trans-2-Aminocyclo hexanol hydrochloride
- Molecular Formula: C6H14ClNO
- Molecular Weight: 151.63
- InChI Key: LKKCSUHCVGCGFA-GEMLJDPKSA-N
- InChI: InChI=1S/C6H13NO.ClH/c7-5-3-1-2-4-6(5)8;/h5-6,8H,1-4,7H2;1H/t5-,6-;/m0./s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 151.635 |
| Density: | N/A |
| CAS: | 13374-30-6 |
| Bolling_Point: | 201.1ºC at 760 mmHg |
| Product_Name: | Trans-2-Aminocyclohexanol HCl |
| Melting_Point: | N/A |
| Flash_Point: | 75.4ºC |
| MF: | C6H14ClNO |
| LogP: | 1.75090 |
|---|---|
| Flash_Point: | 75.4ºC |
| FW: | 151.635 |
| PSA: | 46.25000 |
| MF: | C6H14ClNO |
| Bolling_Point: | 201.1ºC at 760 mmHg |
| Vapor_Pressure: | 0.0773mmHg at 25°C |
| Exact_Mass: | 151.076385 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H315-H319-H335 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2922199090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)