![1-[2-(Morpholin-4-ylmethyl)phenyl]methanamine (CAS: 91271-82-8) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0658332.png "1-[2-(Morpholin-4-ylmethyl)phenyl]methanamine chemical structure")
1-[2-(Morpholin-4-ylmethyl)phenyl]methanamine
Catalog No: FT-0658332
CAS No: 91271-82-8
- Chemical Name: 1-[2-(Morpholin-4-ylmethyl)phenyl]methanamine
- Molecular Formula: C12H18N2O
- Molecular Weight: 206.28
- InChI Key: NMFAEZHWSZZJOA-UHFFFAOYSA-N
- InChI: InChI=1S/C12H18N2O/c13-9-11-3-1-2-4-12(11)10-14-5-7-15-8-6-14/h1-4H,5-10,13H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 1-[2-(4-Morpholinylmethyl)phenyl]methanamine |
|---|---|
| Bolling_Point: | 318.4±32.0 °C at 760 mmHg |
| Density: | 1.1±0.1 g/cm3 |
| MF: | C12H18N2O |
| CAS: | 91271-82-8 |
| Melting_Point: | N/A |
| Flash_Point: | 146.4±25.1 °C |
| FW: | 206.284 |
| Exact_Mass: | 206.141907 |
|---|---|
| Vapor_Pressure: | 0.0±0.7 mmHg at 25°C |
| MF: | C12H18N2O |
| LogP: | 0.22 |
| Bolling_Point: | 318.4±32.0 °C at 760 mmHg |
| Density: | 1.1±0.1 g/cm3 |
| PSA: | 38.49000 |
| FW: | 206.284 |
| Flash_Point: | 146.4±25.1 °C |
| Refractive_Index: | 1.569 |
| Risk_Statements(EU): | R22;R34 |
|---|---|
| Hazard_Codes: | C: Corrosive; |
| Safety_Statements: | 23-26-36/37/39-45 |
| HS_Code: | 2934999090 |
| RIDADR: | UN 2735 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)