Cloquintocet
Catalog No: FT-0657214
CAS No: 88349-88-6
- Chemical Name: Cloquintocet
- Molecular Formula: C11H8ClNO3
- Molecular Weight: 237.64
- InChI Key: ICJSJAJWTWPSBD-UHFFFAOYSA-N
- InChI: InChI=1S/C11H8ClNO3/c12-8-3-4-9(16-6-10(14)15)11-7(8)2-1-5-13-11/h1-5H,6H2,(H,14,15)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 237.63900 |
| Density: | 1.45 |
| CAS: | 88349-88-6 |
| Bolling_Point: | 435ºC at 760 mmHg |
| Product_Name: | cloquintocet |
| Melting_Point: | 121-126ºC |
| Flash_Point: | 216.9ºC |
| MF: | C11H8ClNO3 |
| Density: | 1.45 |
|---|---|
| LogP: | 2.35160 |
| Flash_Point: | 216.9ºC |
| Melting_Point: | 121-126ºC |
| FW: | 237.63900 |
| PSA: | 59.42000 |
| Exact_Mass: | 237.01900 |
| MF: | C11H8ClNO3 |
| Bolling_Point: | 435ºC at 760 mmHg |
| Refractive_Index: | 1.653 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Hazard_Codes: | Xn: Harmful; |
| Risk_Statements(EU): | 22 |
| Safety_Statements: | H302 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933499090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)