7-Chlorooxindole
Catalog No: FT-0656933
CAS No: 25369-33-9
- Chemical Name: 7-Chlorooxindole
- Molecular Formula: C8H6ClNO
- Molecular Weight: 167.59
- InChI Key: FPDLUAACCNVSQA-UHFFFAOYSA-N
- InChI: InChI=1S/C8H6ClNO/c9-6-3-1-2-5-4-7(11)10-8(5)6/h1-3H,4H2,(H,10,11)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 25369-33-9 |
| Flash_Point: | 160.0±27.9 °C |
| Product_Name: | 5-Chlorooxindole |
| Bolling_Point: | 341.0±42.0 °C at 760 mmHg |
| FW: | 167.592 |
| Melting_Point: | 221-225ºC |
| MF: | C8H6ClNO |
| Density: | 1.4±0.1 g/cm3 |
| Refractive_Index: | 1.602 |
|---|---|
| Vapor_Pressure: | 0.0±0.7 mmHg at 25°C |
| Flash_Point: | 160.0±27.9 °C |
| LogP: | 1.35 |
| Bolling_Point: | 341.0±42.0 °C at 760 mmHg |
| FW: | 167.592 |
| PSA: | 29.10000 |
| Melting_Point: | 221-225ºC |
| MF: | C8H6ClNO |
| Exact_Mass: | 167.013794 |
| Density: | 1.4±0.1 g/cm3 |
| Symbol: | GHS07 |
|---|---|
| Risk_Statements(EU): | R22 |
| HS_Code: | 2933790090 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xn: Harmful; |
| Warning_Statement: | P305 + P351 + P338 |
| Safety_Statements: | H302-H319 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)