N-(Acetoacetyl)anthranilic acid
Catalog No: FT-0654245
CAS No: 35354-86-0
- Chemical Name: N-(Acetoacetyl)anthranilic acid
- Molecular Formula: C11H11NO4
- Molecular Weight: 221.21
- InChI Key: QINYBRXZAIWZBM-UHFFFAOYSA-N
- InChI: InChI=1S/C11H11NO4/c1-7(13)6-10(14)12-9-5-3-2-4-8(9)11(15)16/h2-5H,6H2,1H3,(H,12,14)(H,15,16)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 2-(3-oxobutanoylamino)benzoic acid |
|---|---|
| Flash_Point: | 162.7℃ |
| Melting_Point: | 86.6℃ |
| FW: | 221.20900 |
| Density: | 1.1320 |
| CAS: | 35354-86-0 |
| Bolling_Point: | 478.7ºC at 760 mmHg |
| MF: | C11H11NO4 |
| Density: | 1.1320 |
|---|---|
| Computational_Chemistry: | ['1. XlogP :N/A ', '2. Hydrogen Bond Donor Count :2 ', '3. Hydrogen Bond Acceptor Count :4 ', '4. Rotatable Bond Count :4 ', '5. Isotope Atom Count :23 ', '6. TPSA 835 ', '7. Heavy Atom Count :16 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :300 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| LogP: | 1.37540 |
| Flash_Point: | 162.7℃ |
| Melting_Point: | 86.6℃ |
| FW: | 221.20900 |
| PSA: | 83.47000 |
| Exact_Mass: | 221.06900 |
| MF: | C11H11NO4 |
| Bolling_Point: | 478.7ºC at 760 mmHg |
| Refractive_Index: | 1.603 |
| Hazard_Codes: | Xn,T,Xi |
|---|---|
| Risk_Statements(EU): | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed . R36/37/38:Irritating to eyes, respiratory system and skin . |
| Packing_Group: | III |
| Hazard_Class: | 6.1 |
| RIDADR: | UN 3439 6.1/PG 3 |
| HS_Code: | 29269095 |
| WGK_Germany: | 3 |
| Safety_Statements: | S26-S37/39-S36/37/39 |
