6-BROMO-1H-PYRROLO[3,2-B]PYRIDINE
Catalog No: FT-0653827
CAS No: 944937-53-5
- Chemical Name: 6-BROMO-1H-PYRROLO[3,2-B]PYRIDINE
- Molecular Formula: C7H5BrN2
- Molecular Weight: 197.03
- InChI Key: OJFFFCVPCVATIV-UHFFFAOYSA-N
- InChI: InChI=1S/C7H5BrN2/c8-5-3-7-6(10-4-5)1-2-9-7/h1-4,9H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 197.032 |
| Density: | 1.8±0.1 g/cm3 |
| CAS: | 944937-53-5 |
| Bolling_Point: | 311.3±22.0 °C at 760 mmHg |
| Product_Name: | 6-Bromo-4-azaindole |
| Melting_Point: | N/A |
| Flash_Point: | 142.1±22.3 °C |
| MF: | C7H5BrN2 |
| Density: | 1.8±0.1 g/cm3 |
|---|---|
| LogP: | 1.72 |
| Flash_Point: | 142.1±22.3 °C |
| Refractive_Index: | 1.728 |
| FW: | 197.032 |
| PSA: | 28.68000 |
| MF: | C7H5BrN2 |
| Bolling_Point: | 311.3±22.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| Exact_Mass: | 195.963608 |
| Hazard_Codes: | Xi |
|---|---|
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
| Safety_Statements: | H302-H315-H318-H335 |
| Symbol: | Danger |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)