Mizoribine
Catalog No: FT-0652030
CAS No: 50924-49-7
- Chemical Name: Mizoribine
- Molecular Formula: C9H13N3O6
- Molecular Weight: 259.22
- InChI Key: HZQDCMWJEBCWBR-UUOKFMHZSA-N
- InChI: InChI=1S/C9H13N3O6/c10-7(16)4-8(17)12(2-11-4)9-6(15)5(14)3(1-13)18-9/h2-3,5-6,9,13-15,17H,1H2,(H2,10,16)/t3-,5-,6-,9-/m1/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07, GHS08 |
|---|---|
| CAS: | 50924-49-7 |
| Flash_Point: | 410.9±32.9 °C |
| Product_Name: | Mizoribine |
| Bolling_Point: | 755.9±60.0 °C at 760 mmHg |
| FW: | 259.216 |
| Melting_Point: | >200ºC |
| MF: | C9H13N3O6 |
| Density: | 2.1±0.1 g/cm3 |
| Refractive_Index: | 1.795 |
|---|---|
| Vapor_Pressure: | 0.0±2.7 mmHg at 25°C |
| Flash_Point: | 410.9±32.9 °C |
| LogP: | -0.17 |
| Bolling_Point: | 755.9±60.0 °C at 760 mmHg |
| FW: | 259.216 |
| PSA: | 151.06000 |
| Melting_Point: | >200ºC |
| MF: | C9H13N3O6 |
| Exact_Mass: | 259.080444 |
| Density: | 2.1±0.1 g/cm3 |
| Symbol: | GHS07, GHS08 |
|---|---|
| Risk_Statements(EU): | R46 |
| Personal_Protective_Equipment: | Eyeshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| RTECS: | NI3980000 |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | T: Toxic; |
| Warning_Statement: | P201-P261-P305 + P351 + P338-P308 + P313 |
| Safety_Statements: | H315-H319-H335-H360 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)