3,5-Difluoropicolinic acid
Catalog No: FT-0649906
CAS No: 745784-04-7
- Chemical Name: 3,5-Difluoropicolinic acid
- Molecular Formula: C6H3F2NO2
- Molecular Weight: 159.09
- InChI Key: QKLXAJQKMIWFRC-UHFFFAOYSA-N
- InChI: InChI=1S/C6H3F2NO2/c7-3-1-4(8)5(6(10)11)9-2-3/h1-2H,(H,10,11)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 159.090 |
| Density: | 1.5±0.1 g/cm3 |
| CAS: | 745784-04-7 |
| Bolling_Point: | 240.6±35.0 °C at 760 mmHg |
| Product_Name: | 3,5-Difluoropyridine-2-carboxylic acid |
| Melting_Point: | 202-204ºC |
| Flash_Point: | 99.3±25.9 °C |
| MF: | C6H3F2NO2 |
| Density: | 1.5±0.1 g/cm3 |
|---|---|
| LogP: | 0.06 |
| Flash_Point: | 99.3±25.9 °C |
| Melting_Point: | 202-204ºC |
| FW: | 159.090 |
| PSA: | 50.19000 |
| Exact_Mass: | 159.013184 |
| MF: | C6H3F2NO2 |
| Bolling_Point: | 240.6±35.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.5 mmHg at 25°C |
| Refractive_Index: | 1.515 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H315-H319-H335 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933399090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)