2-Bromo-5-methylbenzenamine
Catalog No: FT-0649604
CAS No: 53078-85-6
- Chemical Name: 2-Bromo-5-methylbenzenamine
- Molecular Formula: C7H8BrN
- Molecular Weight: 186.05
- InChI Key: QTAQWOXSUFGGKH-UHFFFAOYSA-N
- InChI: InChI=1S/C7H8BrN/c1-5-2-3-6(8)7(9)4-5/h2-4H,9H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 186.049 |
| Density: | 1.5±0.1 g/cm3 |
| CAS: | 53078-85-6 |
| Bolling_Point: | 247.9±20.0 °C at 760 mmHg |
| Product_Name: | 2-Bromo-5-methylaniline |
| Melting_Point: | N/A |
| Flash_Point: | 103.8±21.8 °C |
| MF: | C7H8BrN |
| Density: | 1.5±0.1 g/cm3 |
|---|---|
| LogP: | 2.65 |
| Flash_Point: | 103.8±21.8 °C |
| Refractive_Index: | 1.609 |
| FW: | 186.049 |
| PSA: | 26.02000 |
| MF: | C7H8BrN |
| Bolling_Point: | 247.9±20.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.5 mmHg at 25°C |
| Exact_Mass: | 184.984009 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
|---|---|
| Hazard_Codes: | Xn: Harmful; |
| Risk_Statements(EU): | R22 |
| Safety_Statements: | H302 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2921430090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)