N-(2,3-dihydro-1,5-dimethyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)formamide
Catalog No: FT-0648425
CAS No: 1672-58-8
- Chemical Name: N-(2,3-dihydro-1,5-dimethyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)formamide
- Molecular Formula: C12H13N3O2
- Molecular Weight: 231.25
- InChI Key: WSJBSKRPKADYRQ-UHFFFAOYSA-N
- InChI: InChI=1S/C12H13N3O2/c1-9-11(13-8-16)12(17)15(14(9)2)10-6-4-3-5-7-10/h3-8H,1-2H3,(H,13,16)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 4-Formamidoantipyrine |
|---|---|
| Bolling_Point: | 374.5±52.0 °C at 760 mmHg |
| MF: | C12H13N3O2 |
| Symbol: | GHS07 |
| Melting_Point: | 189-192ºC |
| CAS: | 1672-58-8 |
| Density: | 1.2±0.1 g/cm3 |
| FW: | 231.251 |
| Flash_Point: | 180.3±30.7 °C |
| Vapor_Pressure: | 0.0±0.9 mmHg at 25°C |
|---|---|
| Exact_Mass: | 231.100784 |
| Refractive_Index: | 1.609 |
| LogP: | 0.41 |
| Bolling_Point: | 374.5±52.0 °C at 760 mmHg |
| Density: | 1.2±0.1 g/cm3 |
| MF: | C12H13N3O2 |
| PSA: | 56.03000 |
| FW: | 231.251 |
| Flash_Point: | 180.3±30.7 °C |
| Melting_Point: | 189-192ºC |
| HS_Code: | 2933199090 |
|---|---|
| Safety_Statements: | H302 |
| Warning_Statement: | P301 + P312 + P330 |
| Symbol: | GHS07 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)