![5-CHLORO-1H-PYRROLO[3,2-B] PYRIDINE (CAS: 65156-94-7) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0647229.png "5-CHLORO-1H-PYRROLO[3,2-B] PYRIDINE chemical structure")
5-CHLORO-1H-PYRROLO[3,2-B] PYRIDINE
Catalog No: FT-0647229
CAS No: 65156-94-7
- Chemical Name: 5-CHLORO-1H-PYRROLO[3,2-B] PYRIDINE
- Molecular Formula: C7H5ClN2
- Molecular Weight: 152.58
- InChI Key: RFPQVCYUKAYKEG-UHFFFAOYSA-N
- InChI: InChI=1S/C7H5ClN2/c8-7-2-1-5-6(10-7)3-4-9-5/h1-4,9H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 152.581 |
| Density: | 1.4±0.1 g/cm3 |
| CAS: | 65156-94-7 |
| Bolling_Point: | 304.9±22.0 °C at 760 mmHg |
| Product_Name: | 5-Chloro-4-azaindole |
| Melting_Point: | N/A |
| Flash_Point: | 166.8±7.9 °C |
| MF: | C7H5ClN2 |
| Density: | 1.4±0.1 g/cm3 |
|---|---|
| LogP: | 1.59 |
| Flash_Point: | 166.8±7.9 °C |
| Refractive_Index: | 1.703 |
| FW: | 152.581 |
| PSA: | 28.68000 |
| MF: | C7H5ClN2 |
| Bolling_Point: | 304.9±22.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| Exact_Mass: | 152.014130 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| Warning_Statement: | P280-P305 + P351 + P338 |
| Safety_Statements: | H302-H318 |
| Symbol: | Danger |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
