1-methyl-1,2,3,4-tetrahydroisoquinoline
Catalog No: FT-0645680
CAS No: 4965-09-7
- Chemical Name: 1-methyl-1,2,3,4-tetrahydroisoquinoline
- Molecular Formula: C10H13N
- Molecular Weight: 147.22
- InChI Key: QPILYVQSKNWRDD-UHFFFAOYSA-N
- InChI: InChI=1S/C10H13N/c1-8-10-5-3-2-4-9(10)6-7-11-8/h2-5,8,11H,6-7H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 1-Methyl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| Bolling_Point: | 239.3±9.0 °C at 760 mmHg |
| MF: | C10H13N |
| Symbol: | GHS07 |
| Melting_Point: | N/A |
| CAS: | 4965-09-7 |
| Density: | 1.0±0.1 g/cm3 |
| FW: | 147.217 |
| Flash_Point: | 100.0±14.2 °C |
| Exact_Mass: | 147.104797 |
|---|---|
| Vapor_Pressure: | 0.0±0.5 mmHg at 25°C |
| MF: | C10H13N |
| LogP: | 1.90 |
| Bolling_Point: | 239.3±9.0 °C at 760 mmHg |
| Density: | 1.0±0.1 g/cm3 |
| PSA: | 12.03000 |
| FW: | 147.217 |
| Flash_Point: | 100.0±14.2 °C |
| Refractive_Index: | 1.522 |
| HS_Code: | 2933990090 |
|---|---|
| Safety_Statements: | H302-H315-H319-H335 |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Symbol: | GHS07 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)